N-Acetyldopamine
Identifiers | |
---|---|
CAS Number |
|
3D model (JSmol) |
|
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
PubChem CID |
|
CompTox Dashboard (EPA) |
|
InChI
| |
| |
Properties | |
Chemical formula | C10H13NO3 |
Molar mass | 195.218 g·mol−1 |
Appearance | Colorless solid |
Hazards | |
GHS labelling:[1] | |
Pictograms | |
Warning | |
Hazard statements | H315, H319, H335 |
Precautionary statements | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Chemical compound
N-Acetyldopamine is the organic compound with the formula CH3C(O)NHCH2CH2C6H3(OH)2. It is the N-acetylated derivative of dopamine. This compound is a reactive intermediate in sclerotization, the process by which insect cuticles are formed by hardening molecular precursors. The catechol substituent is susceptible to redox and crosslinking.[2][3]
References
- ^ "N-Acetyldopamine". pubchem.ncbi.nlm.nih.gov. Retrieved 26 February 2022.
- ^ Andersen, Svend Olav (2010). "Insect cuticular sclerotization: A review". Insect Biochemistry and Molecular Biology. 40 (3): 166–178. doi:10.1016/j.ibmb.2009.10.007. PMID 19932179.
- ^ Kramer, Karl J.; Kanost, Michael R.; Hopkins, Theodore L.; Jiang, Haobo; Zhu, Yu Cheng; Xu, Rongda; Kerwin, J.L; Turecek, F. (2001). "Oxidative conjugation of catechols with proteins in insect skeletal systems". Tetrahedron. 57 (2): 385–392. doi:10.1016/S0040-4020(00)00949-2.